C12H6F13NO2 — CID 102408237
1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)pyrrole-2,5-dione (PubChem CID 102408237) has the molecular formula C12H6F13NO2 and a molecular weight of 443.16 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)pyrrole-2,5-dione.
| Compound Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 102408237 |
| Molecular Formula | C12H6F13NO2 |
| Molecular Weight | 443.16 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | 1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H6F13NO2/c13-7(14,3-4-26-5(27)1-2-6(26)28)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h1-2H,3-4H2 |
| InChIKey | CYCCCPTUBYLZBE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.16 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|