C8H5F6NO2 — CID 19821162
1-(2,2,3,4,4,4-hexafluorobutyl)pyrrole-2,5-dione (PubChem CID 19821162) has the molecular formula C8H5F6NO2 and a molecular weight of 261.12 g/mol. Its IUPAC name is 1-(2,2,3,4,4,4-hexafluorobutyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,2,3,4,4,4-hexafluorobutyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 19821162 |
| Molecular Formula | C8H5F6NO2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 1-(2,2,3,4,4,4-hexafluorobutyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F6NO2/c9-6(8(12,13)14)7(10,11)3-15-4(16)1-2-5(15)17/h1-2,6H,3H2 |
| InChIKey | XHYMORGFRWRLJV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|