C13H4F17NO2 — CID 59018781
1-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)pyrrole-2,5-dione (PubChem CID 59018781) has the molecular formula C13H4F17NO2 and a molecular weight of 529.15 g/mol. Its IUPAC name is 1-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 59018781 |
| Molecular Formula | C13H4F17NO2 |
| Molecular Weight | 529.15 g/mol |
| Exact Mass | 529.00 |
| IUPAC Name | 1-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H4F17NO2/c14-6(15,3-31-4(32)1-2-5(31)33)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h1-2H,3H2 |
| InChIKey | QCCVLFTUNOZRLL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.15 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|