C15H4F14N2O4 — CID 19774360
1-[7-(2,5-dioxopyrrol-1-yl)-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl]pyrrole-2,5-dione (PubChem CID 19774360) has the molecular formula C15H4F14N2O4 and a molecular weight of 542.18 g/mol. Its IUPAC name is 1-[7-(2,5-dioxopyrrol-1-yl)-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl]pyrrole-2,5-dione.
| Compound Name | 1-[7-(2,5-dioxopyrrol-1-yl)-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 19774360 |
| Molecular Formula | C15H4F14N2O4 |
| Molecular Weight | 542.18 g/mol |
| Exact Mass | 541.99 |
| IUPAC Name | 1-[7-(2,5-dioxopyrrol-1-yl)-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H4F14N2O4/c16-9(17,10(18,19)12(22,23)14(26,27)30-5(32)1-2-6(30)33)11(20,21)13(24,25)15(28,29)31-7(34)3-4-8(31)35/h1-4H |
| InChIKey | ZZDWWDFOZIOCQG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.18 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|