C12H4F8N2O4 — CID 19774370
1-[4-(2,5-dioxopyrrol-1-yl)-1,1,2,2,3,3,4,4-octafluorobutyl]pyrrole-2,5-dione (PubChem CID 19774370) has the molecular formula C12H4F8N2O4 and a molecular weight of 392.16 g/mol. Its IUPAC name is 1-[4-(2,5-dioxopyrrol-1-yl)-1,1,2,2,3,3,4,4-octafluorobutyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-(2,5-dioxopyrrol-1-yl)-1,1,2,2,3,3,4,4-octafluorobutyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 19774370 |
| Molecular Formula | C12H4F8N2O4 |
| Molecular Weight | 392.16 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 1-[4-(2,5-dioxopyrrol-1-yl)-1,1,2,2,3,3,4,4-octafluorobutyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H4F8N2O4/c13-9(14,11(17,18)21-5(23)1-2-6(21)24)10(15,16)12(19,20)22-7(25)3-4-8(22)26/h1-4H |
| InChIKey | DKUUGXPHLCBFGP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|