C12H3F16NO2 — CID 88810332
1-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl)pyrrole-2,5-dione (PubChem CID 88810332) has the molecular formula C12H3F16NO2 and a molecular weight of 497.13 g/mol. Its IUPAC name is 1-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl)pyrrole-2,5-dione.
| Compound Name | 1-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 88810332 |
| Molecular Formula | C12H3F16NO2 |
| Molecular Weight | 497.13 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | 1-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H3F16NO2/c13-5(29-3(30)1-2-4(29)31)6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)28/h1-2,5H |
| InChIKey | CCYJRQZAHQQPKI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.13 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|