C8H3F8NO2 — CID 88525429
1-(1,2,2,3,3,4,4,4-octafluorobutyl)pyrrole-2,5-dione (PubChem CID 88525429) has the molecular formula C8H3F8NO2 and a molecular weight of 297.10 g/mol. Its IUPAC name is 1-(1,2,2,3,3,4,4,4-octafluorobutyl)pyrrole-2,5-dione.
| Compound Name | 1-(1,2,2,3,3,4,4,4-octafluorobutyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 88525429 |
| Molecular Formula | C8H3F8NO2 |
| Molecular Weight | 297.10 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 1-(1,2,2,3,3,4,4,4-octafluorobutyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H3F8NO2/c9-5(17-3(18)1-2-4(17)19)6(10,11)7(12,13)8(14,15)16/h1-2,5H |
| InChIKey | ZNXMECJIZPYOGX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.10 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|