C9H15NO2Si — CID 67677734
1-(1-trimethylsilylethyl)pyrrole-2,5-dione (PubChem CID 67677734) has the molecular formula C9H15NO2Si and a molecular weight of 197.31 g/mol. Its IUPAC name is 1-(1-trimethylsilylethyl)pyrrole-2,5-dione.
| Compound Name | 1-(1-trimethylsilylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67677734 |
| Molecular Formula | C9H15NO2Si |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 1-(1-trimethylsilylethyl)pyrrole-2,5-dione |
| SMILES | CC(N1C(=O)C=CC1=O)[Si](C)(C)C |
| InChI | InChI=1S/C9H15NO2Si/c1-7(13(2,3)4)10-8(11)5-6-9(10)12/h5-7H,1-4H3 |
| InChIKey | QKPKAPIGJGNQOW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|