C6H8NO5P — CID 67705894
1-(2,5-dioxopyrrol-1-yl)ethylphosphonic acid (PubChem CID 67705894) has the molecular formula C6H8NO5P and a molecular weight of 205.11 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrol-1-yl)ethylphosphonic acid.
| Compound Name | 1-(2,5-dioxopyrrol-1-yl)ethylphosphonic acid |
|---|---|
| PubChem CID | 67705894 |
| Molecular Formula | C6H8NO5P |
| Molecular Weight | 205.11 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 1-(2,5-dioxopyrrol-1-yl)ethylphosphonic acid |
| SMILES | CC(N1C(=O)C=CC1=O)P(=O)(O)O |
| InChI | InChI=1S/C6H8NO5P/c1-4(13(10,11)12)7-5(8)2-3-6(7)9/h2-4H,1H3,(H2,10,11,12) |
| InChIKey | YJCBQBSDMFOWFI-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.11 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|