C10H11NO5 — CID 152668758
2-(2,5-dioxopyrrol-1-yl)-4-methyl-3-oxopentanoic acid (PubChem CID 152668758) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-4-methyl-3-oxopentanoic acid.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)-4-methyl-3-oxopentanoic acid |
|---|---|
| PubChem CID | 152668758 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)-4-methyl-3-oxopentanoic acid |
| SMILES | CC(C)C(=O)C(C(=O)O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H11NO5/c1-5(2)9(14)8(10(15)16)11-6(12)3-4-7(11)13/h3-5,8H,1-2H3,(H,15,16) |
| InChIKey | ZLBOTHOFCNKIAI-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|