C18H24N4O4+2 — CID 69493446
1-[1-[4-[1-(2,5-dioxopyrrol-1-yl)ethyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]pyrrole-2,5-dione (PubChem CID 69493446) has the molecular formula C18H24N4O4+2 and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-[1-[4-[1-(2,5-dioxopyrrol-1-yl)ethyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[1-[4-[1-(2,5-dioxopyrrol-1-yl)ethyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 69493446 |
| Molecular Formula | C18H24N4O4+2 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1-[1-[4-[1-(2,5-dioxopyrrol-1-yl)ethyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]pyrrole-2,5-dione |
| SMILES | CC(N1C(=O)C=CC1=O)[N+]12CC[N+](C(C)N3C(=O)C=CC3=O)(CC1)CC2 |
| InChI | InChI=1S/C18H24N4O4/c1-13(19-15(23)3-4-16(19)24)21-7-10-22(11-8-21,12-9-21)14(2)20-17(25)5-6-18(20)26/h3-6,13-14H,7-12H2,1-2H3/q+2 |
| InChIKey | LFEBFMIIUXNJQJ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|