C9H12N2O2 — CID 65194125
1-(2-amino-1-cyclopropylethyl)pyrrole-2,5-dione (PubChem CID 65194125) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-(2-amino-1-cyclopropylethyl)pyrrole-2,5-dione.
| Compound Name | 1-(2-amino-1-cyclopropylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 65194125 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1-(2-amino-1-cyclopropylethyl)pyrrole-2,5-dione |
| SMILES | NCC(C1CC1)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H12N2O2/c10-5-7(6-1-2-6)11-8(12)3-4-9(11)13/h3-4,6-7H,1-2,5,10H2 |
| InChIKey | PIESOUZCNYZGTD-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|