C15H7F3N2O4 — CID 141169954
1-[3-(2,5-dioxopyrrol-1-yl)-2-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 141169954) has the molecular formula C15H7F3N2O4 and a molecular weight of 336.23 g/mol. Its IUPAC name is 1-[3-(2,5-dioxopyrrol-1-yl)-2-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-(2,5-dioxopyrrol-1-yl)-2-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 141169954 |
| Molecular Formula | C15H7F3N2O4 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 1-[3-(2,5-dioxopyrrol-1-yl)-2-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1cccc(N2C(=O)C=CC2=O)c1C(F)(F)F |
| InChI | InChI=1S/C15H7F3N2O4/c16-15(17,18)14-8(19-10(21)4-5-11(19)22)2-1-3-9(14)20-12(23)6-7-13(20)24/h1-7H |
| InChIKey | HXKWJMSRZUSPLN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|