C18H23NO2 — CID 60920511
N-(2-cyclopentylethyl)-3-(4-hydroxybut-1-ynyl)benzamide (PubChem CID 60920511) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-(2-cyclopentylethyl)-3-(4-hydroxybut-1-ynyl)benzamide.
| Compound Name | N-(2-cyclopentylethyl)-3-(4-hydroxybut-1-ynyl)benzamide |
|---|---|
| PubChem CID | 60920511 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-(2-cyclopentylethyl)-3-(4-hydroxybut-1-ynyl)benzamide |
| SMILES | O=C(NCCC1CCCC1)c1cccc(C#CCCO)c1 |
| InChI | InChI=1S/C18H23NO2/c20-13-4-3-8-16-9-5-10-17(14-16)18(21)19-12-11-15-6-1-2-7-15/h5,9-10,14-15,20H,1-2,4,6-7,11-13H2,(H,19,21) |
| InChIKey | DEXPAGNFTVDRJT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|