C16H20N2O3 — CID 106279754
N-(3-amino-2,2-dimethyl-3-oxopropyl)-3-(4-hydroxybut-1-ynyl)benzamide (PubChem CID 106279754) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethyl-3-oxopropyl)-3-(4-hydroxybut-1-ynyl)benzamide.
| Compound Name | N-(3-amino-2,2-dimethyl-3-oxopropyl)-3-(4-hydroxybut-1-ynyl)benzamide |
|---|---|
| PubChem CID | 106279754 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-(3-amino-2,2-dimethyl-3-oxopropyl)-3-(4-hydroxybut-1-ynyl)benzamide |
| SMILES | CC(C)(CNC(=O)c1cccc(C#CCCO)c1)C(N)=O |
| InChI | InChI=1S/C16H20N2O3/c1-16(2,15(17)21)11-18-14(20)13-8-5-7-12(10-13)6-3-4-9-19/h5,7-8,10,19H,4,9,11H2,1-2H3,(H2,17,21)(H,18,20) |
| InChIKey | LLVCTCKQDWJXRK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|