C17H18N4 — CID 60922847
N-[[2-(aminomethyl)phenyl]methyl]-N-methylphthalazin-1-amine (PubChem CID 60922847) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[[2-(aminomethyl)phenyl]methyl]-N-methylphthalazin-1-amine.
| Compound Name | N-[[2-(aminomethyl)phenyl]methyl]-N-methylphthalazin-1-amine |
|---|---|
| PubChem CID | 60922847 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-[[2-(aminomethyl)phenyl]methyl]-N-methylphthalazin-1-amine |
| SMILES | CN(Cc1ccccc1CN)c1nncc2ccccc12 |
| InChI | InChI=1S/C17H18N4/c1-21(12-15-8-3-2-6-13(15)10-18)17-16-9-5-4-7-14(16)11-19-20-17/h2-9,11H,10,12,18H2,1H3 |
| InChIKey | FVXXCFKFEORFJC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |