C13H18N4 — CID 63225812
3-N-methyl-3-N-phthalazin-1-ylbutane-1,3-diamine (PubChem CID 63225812) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-N-methyl-3-N-phthalazin-1-ylbutane-1,3-diamine.
| Compound Name | 3-N-methyl-3-N-phthalazin-1-ylbutane-1,3-diamine |
|---|---|
| PubChem CID | 63225812 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-N-methyl-3-N-phthalazin-1-ylbutane-1,3-diamine |
| SMILES | CC(CCN)N(C)c1nncc2ccccc12 |
| InChI | InChI=1S/C13H18N4/c1-10(7-8-14)17(2)13-12-6-4-3-5-11(12)9-15-16-13/h3-6,9-10H,7-8,14H2,1-2H3 |
| InChIKey | QXUSTLKIEGKXTB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |