C14H23N3O2S — CID 60922991
N-[[2-(aminomethyl)phenyl]methyl]-N-methylpiperidine-1-sulfonamide (PubChem CID 60922991) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-[[2-(aminomethyl)phenyl]methyl]-N-methylpiperidine-1-sulfonamide.
| Compound Name | N-[[2-(aminomethyl)phenyl]methyl]-N-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 60922991 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[[2-(aminomethyl)phenyl]methyl]-N-methylpiperidine-1-sulfonamide |
| SMILES | CN(Cc1ccccc1CN)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H23N3O2S/c1-16(12-14-8-4-3-7-13(14)11-15)20(18,19)17-9-5-2-6-10-17/h3-4,7-8H,2,5-6,9-12,15H2,1H3 |
| InChIKey | JMMXJKPYRXRSIT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |