C12H16N2O5S — CID 60929862
2-amino-4-[(2-methoxy-5-nitrophenyl)methylsulfanyl]butanoic acid (PubChem CID 60929862) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-amino-4-[(2-methoxy-5-nitrophenyl)methylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[(2-methoxy-5-nitrophenyl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 60929862 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-amino-4-[(2-methoxy-5-nitrophenyl)methylsulfanyl]butanoic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1CSCCC(N)C(=O)O |
| InChI | InChI=1S/C12H16N2O5S/c1-19-11-3-2-9(14(17)18)6-8(11)7-20-5-4-10(13)12(15)16/h2-3,6,10H,4-5,7,13H2,1H3,(H,15,16) |
| InChIKey | LBIHMWIJHXHCRM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|