C14H19BrN2O3 — CID 60932946
ethyl 4-[(4-bromo-1H-pyrrole-2-carbonyl)amino]cyclohexane-1-carboxylate (PubChem CID 60932946) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is ethyl 4-[(4-bromo-1H-pyrrole-2-carbonyl)amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[(4-bromo-1H-pyrrole-2-carbonyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 60932946 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | ethyl 4-[(4-bromo-1H-pyrrole-2-carbonyl)amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(NC(=O)c2cc(Br)c[nH]2)CC1 |
| InChI | InChI=1S/C14H19BrN2O3/c1-2-20-14(19)9-3-5-11(6-4-9)17-13(18)12-7-10(15)8-16-12/h7-9,11,16H,2-6H2,1H3,(H,17,18) |
| InChIKey | XXGWGZRULZCNAX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |