C15H14N4O2 — CID 60933132
1-cyclopropyl-3-(quinoxalin-6-ylamino)pyrrolidine-2,5-dione (PubChem CID 60933132) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1-cyclopropyl-3-(quinoxalin-6-ylamino)pyrrolidine-2,5-dione.
| Compound Name | 1-cyclopropyl-3-(quinoxalin-6-ylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 60933132 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-cyclopropyl-3-(quinoxalin-6-ylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Nc2ccc3nccnc3c2)C(=O)N1C1CC1 |
| InChI | InChI=1S/C15H14N4O2/c20-14-8-13(15(21)19(14)10-2-3-10)18-9-1-4-11-12(7-9)17-6-5-16-11/h1,4-7,10,13,18H,2-3,8H2 |
| InChIKey | XNHAFTPOHXTZRT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|