C9H8N4S — CID 609340
11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 609340) has the molecular formula C9H8N4S and a molecular weight of 204.26 g/mol. Its IUPAC name is 11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 609340 |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1sc2ncn3ncnc3c2c1C |
| InChI | InChI=1S/C9H8N4S/c1-5-6(2)14-9-7(5)8-10-3-12-13(8)4-11-9/h3-4H,1-2H3 |
| InChIKey | QULZRAJLUWHOKV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |