C13H13N5OS2 — CID 665843
2-(10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-ylsulfanyl)acetamide (PubChem CID 665843) has the molecular formula C13H13N5OS2 and a molecular weight of 319.42 g/mol. Its IUPAC name is 2-(10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-ylsulfanyl)acetamide.
| Compound Name | 2-(10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 665843 |
| Molecular Formula | C13H13N5OS2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-(10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-ylsulfanyl)acetamide |
| SMILES | NC(=O)CSc1nc2sc3c(c2c2ncnn12)CCCC3 |
| InChI | InChI=1S/C13H13N5OS2/c14-9(19)5-20-13-17-12-10(11-15-6-16-18(11)13)7-3-1-2-4-8(7)21-12/h6H,1-5H2,(H2,14,19) |
| InChIKey | MVNZAICSUAMHKQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |