C16H27N3O — CID 60937207
1-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-(propan-2-ylamino)butan-1-one (PubChem CID 60937207) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-(propan-2-ylamino)butan-1-one.
| Compound Name | 1-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-(propan-2-ylamino)butan-1-one |
|---|---|
| PubChem CID | 60937207 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 1-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-(propan-2-ylamino)butan-1-one |
| SMILES | Cc1ccc2n1CCN(C(=O)CCCNC(C)C)C2C |
| InChI | InChI=1S/C16H27N3O/c1-12(2)17-9-5-6-16(20)19-11-10-18-13(3)7-8-15(18)14(19)4/h7-8,12,14,17H,5-6,9-11H2,1-4H3 |
| InChIKey | QNADMYGHKNIMLQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|