C14H19F3N2O — CID 60938216
2-amino-N-benzyl-N-(2,2,2-trifluoroethyl)pentanamide (PubChem CID 60938216) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-amino-N-benzyl-N-(2,2,2-trifluoroethyl)pentanamide.
| Compound Name | 2-amino-N-benzyl-N-(2,2,2-trifluoroethyl)pentanamide |
|---|---|
| PubChem CID | 60938216 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-amino-N-benzyl-N-(2,2,2-trifluoroethyl)pentanamide |
| SMILES | CCCC(N)C(=O)N(Cc1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C14H19F3N2O/c1-2-6-12(18)13(20)19(10-14(15,16)17)9-11-7-4-3-5-8-11/h3-5,7-8,12H,2,6,9-10,18H2,1H3 |
| InChIKey | NQCCTBFDGWTMIQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |