C34H38N4O2S2 — CID 87772747
2-amino-3-[[(2S)-2-amino-3-(dibenzylamino)-3-oxopropyl]disulfanyl]-N,N-dibenzylpropanamide (PubChem CID 87772747) has the molecular formula C34H38N4O2S2 and a molecular weight of 598.84 g/mol. Its IUPAC name is 2-amino-3-[[(2S)-2-amino-3-(dibenzylamino)-3-oxopropyl]disulfanyl]-N,N-dibenzylpropanamide.
| Compound Name | 2-amino-3-[[(2S)-2-amino-3-(dibenzylamino)-3-oxopropyl]disulfanyl]-N,N-dibenzylpropanamide |
|---|---|
| PubChem CID | 87772747 |
| Molecular Formula | C34H38N4O2S2 |
| Molecular Weight | 598.84 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | 2-amino-3-[[(2S)-2-amino-3-(dibenzylamino)-3-oxopropyl]disulfanyl]-N,N-dibenzylpropanamide |
| SMILES | NC(CSSC[C@@H](N)C(=O)N(Cc1ccccc1)Cc1ccccc1)C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C34H38N4O2S2/c35-31(33(39)37(21-27-13-5-1-6-14-27)22-28-15-7-2-8-16-28)25-41-42-26-32(36)34(40)38(23-29-17-9-3-10-18-29)24-30-19-11-4-12-20-30/h1-20,31-32H,21-26,35-36H2/t31-,32?/m1/s1 |
| InChIKey | BOWSSZXATWMSPH-XGDNGBMYSA-N |
| XLogP | 5.48 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.84 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|