C16H23NO4 — CID 60941221
1-[2-[2-(furan-2-yl)ethylamino]-2-oxoethyl]cycloheptane-1-carboxylic acid (PubChem CID 60941221) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 1-[2-[2-(furan-2-yl)ethylamino]-2-oxoethyl]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[2-[2-(furan-2-yl)ethylamino]-2-oxoethyl]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 60941221 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1-[2-[2-(furan-2-yl)ethylamino]-2-oxoethyl]cycloheptane-1-carboxylic acid |
| SMILES | O=C(CC1(C(=O)O)CCCCCC1)NCCc1ccco1 |
| InChI | InChI=1S/C16H23NO4/c18-14(17-10-7-13-6-5-11-21-13)12-16(15(19)20)8-3-1-2-4-9-16/h5-6,11H,1-4,7-10,12H2,(H,17,18)(H,19,20) |
| InChIKey | AHSHANXNFSSYKI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |