C18H24N2O — CID 60943688
5-[1-(2,4-dimethylphenyl)ethylamino]-1-propylpyridin-2-one (PubChem CID 60943688) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 5-[1-(2,4-dimethylphenyl)ethylamino]-1-propylpyridin-2-one.
| Compound Name | 5-[1-(2,4-dimethylphenyl)ethylamino]-1-propylpyridin-2-one |
|---|---|
| PubChem CID | 60943688 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 5-[1-(2,4-dimethylphenyl)ethylamino]-1-propylpyridin-2-one |
| SMILES | CCCn1cc(NC(C)c2ccc(C)cc2C)ccc1=O |
| InChI | InChI=1S/C18H24N2O/c1-5-10-20-12-16(7-9-18(20)21)19-15(4)17-8-6-13(2)11-14(17)3/h6-9,11-12,15,19H,5,10H2,1-4H3 |
| InChIKey | MZNUKTJSIHVFEP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |