C17H22N2S — CID 60943707
3-pyrrolidin-1-yl-N-(1-thiophen-2-ylpropyl)aniline (PubChem CID 60943707) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 3-pyrrolidin-1-yl-N-(1-thiophen-2-ylpropyl)aniline.
| Compound Name | 3-pyrrolidin-1-yl-N-(1-thiophen-2-ylpropyl)aniline |
|---|---|
| PubChem CID | 60943707 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-pyrrolidin-1-yl-N-(1-thiophen-2-ylpropyl)aniline |
| SMILES | CCC(Nc1cccc(N2CCCC2)c1)c1cccs1 |
| InChI | InChI=1S/C17H22N2S/c1-2-16(17-9-6-12-20-17)18-14-7-5-8-15(13-14)19-10-3-4-11-19/h5-9,12-13,16,18H,2-4,10-11H2,1H3 |
| InChIKey | OOWKCZMZITYJIQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |