C15H15N3OS — CID 43206471
3-(1,3,4-oxadiazol-2-yl)-N-(1-thiophen-2-ylpropyl)aniline (PubChem CID 43206471) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 3-(1,3,4-oxadiazol-2-yl)-N-(1-thiophen-2-ylpropyl)aniline.
| Compound Name | 3-(1,3,4-oxadiazol-2-yl)-N-(1-thiophen-2-ylpropyl)aniline |
|---|---|
| PubChem CID | 43206471 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 3-(1,3,4-oxadiazol-2-yl)-N-(1-thiophen-2-ylpropyl)aniline |
| SMILES | CCC(Nc1cccc(-c2nnco2)c1)c1cccs1 |
| InChI | InChI=1S/C15H15N3OS/c1-2-13(14-7-4-8-20-14)17-12-6-3-5-11(9-12)15-18-16-10-19-15/h3-10,13,17H,2H2,1H3 |
| InChIKey | QNYWHHDQIXSBEJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |