About 2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol
2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol (PubChem CID 65333020) has the molecular formula C13H17N3O2
and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol.
Molecular Properties
| Compound Name | 2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol |
| PubChem CID | 65333020 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol |
| SMILES | CC(Nc1cccc(-c2nnco2)c1)C(C)(C)O |
| InChI | InChI=1S/C13H17N3O2/c1-9(13(2,3)17)15-11-6-4-5-10(7-11)12-16-14-8-18-12/h4-9,15,17H,1-3H3 |
| InChIKey | ZZCCQHLNDSYWFS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol?
The IUPAC name of 2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol (CID 65333020) is 2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol.
What is the SMILES notation for 2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol?
The canonical SMILES for 2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol is CC(Nc1cccc(-c2nnco2)c1)C(C)(C)O.
What is the InChIKey of 2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol?
The InChIKey is ZZCCQHLNDSYWFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2/c1-9(13(2,3)17)15-11-6-4-5-10(7-11)12-16-14-8-18-12/h4-9,15,17H,1-3H3.
What are the key properties of 2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol?
2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol has a molecular weight of 247.30 g/mol, XLogP of 2.31, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[3-(1,3,4-oxadiazol-2-yl)anilino]butan-2-ol is sourced from PubChem (CID 65333020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).