C15H21N3O — CID 43206470
N-heptan-2-yl-3-(1,3,4-oxadiazol-2-yl)aniline (PubChem CID 43206470) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N-heptan-2-yl-3-(1,3,4-oxadiazol-2-yl)aniline.
| Compound Name | N-heptan-2-yl-3-(1,3,4-oxadiazol-2-yl)aniline |
|---|---|
| PubChem CID | 43206470 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-heptan-2-yl-3-(1,3,4-oxadiazol-2-yl)aniline |
| SMILES | CCCCCC(C)Nc1cccc(-c2nnco2)c1 |
| InChI | InChI=1S/C15H21N3O/c1-3-4-5-7-12(2)17-14-9-6-8-13(10-14)15-18-16-11-19-15/h6,8-12,17H,3-5,7H2,1-2H3 |
| InChIKey | MVDLEWTYFLXSLM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|