C13H26N2O4S — CID 60946822
2-amino-N-(1-cyclopropylethyl)-N-(2-methoxyethyl)-4-methylsulfonylbutanamide (PubChem CID 60946822) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-amino-N-(1-cyclopropylethyl)-N-(2-methoxyethyl)-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(1-cyclopropylethyl)-N-(2-methoxyethyl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 60946822 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-amino-N-(1-cyclopropylethyl)-N-(2-methoxyethyl)-4-methylsulfonylbutanamide |
| SMILES | COCCN(C(=O)C(N)CCS(C)(=O)=O)C(C)C1CC1 |
| InChI | InChI=1S/C13H26N2O4S/c1-10(11-4-5-11)15(7-8-19-2)13(16)12(14)6-9-20(3,17)18/h10-12H,4-9,14H2,1-3H3 |
| InChIKey | CALVDNYZSWYPJZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |