C10H15BrN2OS — CID 60947339
2-amino-N-[(4-bromothiophen-2-yl)methyl]-N-methylbutanamide (PubChem CID 60947339) has the molecular formula C10H15BrN2OS and a molecular weight of 291.21 g/mol. Its IUPAC name is 2-amino-N-[(4-bromothiophen-2-yl)methyl]-N-methylbutanamide.
| Compound Name | 2-amino-N-[(4-bromothiophen-2-yl)methyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 60947339 |
| Molecular Formula | C10H15BrN2OS |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 2-amino-N-[(4-bromothiophen-2-yl)methyl]-N-methylbutanamide |
| SMILES | CCC(N)C(=O)N(C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C10H15BrN2OS/c1-3-9(12)10(14)13(2)5-8-4-7(11)6-15-8/h4,6,9H,3,5,12H2,1-2H3 |
| InChIKey | ZYTRIYVEMVSIBN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |