C17H24N2O — CID 60947838
2-(cyclopropylmethylamino)-1-[2-(2-methylphenyl)pyrrolidin-1-yl]ethanone (PubChem CID 60947838) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-1-[2-(2-methylphenyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(cyclopropylmethylamino)-1-[2-(2-methylphenyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 60947838 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-(cyclopropylmethylamino)-1-[2-(2-methylphenyl)pyrrolidin-1-yl]ethanone |
| SMILES | Cc1ccccc1C1CCCN1C(=O)CNCC1CC1 |
| InChI | InChI=1S/C17H24N2O/c1-13-5-2-3-6-15(13)16-7-4-10-19(16)17(20)12-18-11-14-8-9-14/h2-3,5-6,14,16,18H,4,7-12H2,1H3 |
| InChIKey | WOAVPZDTJITUNR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |