C15H20Cl2N2O — CID 60947854
N-cyclopropyl-N-[(3,4-dichlorophenyl)methyl]-4-(methylamino)butanamide (PubChem CID 60947854) has the molecular formula C15H20Cl2N2O and a molecular weight of 315.24 g/mol. Its IUPAC name is N-cyclopropyl-N-[(3,4-dichlorophenyl)methyl]-4-(methylamino)butanamide.
| Compound Name | N-cyclopropyl-N-[(3,4-dichlorophenyl)methyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 60947854 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N-cyclopropyl-N-[(3,4-dichlorophenyl)methyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)N(Cc1ccc(Cl)c(Cl)c1)C1CC1 |
| InChI | InChI=1S/C15H20Cl2N2O/c1-18-8-2-3-15(20)19(12-5-6-12)10-11-4-7-13(16)14(17)9-11/h4,7,9,12,18H,2-3,5-6,8,10H2,1H3 |
| InChIKey | ALRJLLGSAKPQIL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|