C13H20ClN3O3 — CID 60948566
5-chloro-N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methylpentanamide (PubChem CID 60948566) has the molecular formula C13H20ClN3O3 and a molecular weight of 301.77 g/mol. Its IUPAC name is 5-chloro-N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methylpentanamide.
| Compound Name | 5-chloro-N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methylpentanamide |
|---|---|
| PubChem CID | 60948566 |
| Molecular Formula | C13H20ClN3O3 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 5-chloro-N-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)methyl]-N-methylpentanamide |
| SMILES | CN(Cc1cn(C)c(=O)n(C)c1=O)C(=O)CCCCCl |
| InChI | InChI=1S/C13H20ClN3O3/c1-15(11(18)6-4-5-7-14)8-10-9-16(2)13(20)17(3)12(10)19/h9H,4-8H2,1-3H3 |
| InChIKey | WBMCYLIGTKKESO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|