C10H18N2O3S — CID 60949730
N-(1-prop-2-enoylpiperidin-4-yl)ethanesulfonamide (PubChem CID 60949730) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is N-(1-prop-2-enoylpiperidin-4-yl)ethanesulfonamide.
| Compound Name | N-(1-prop-2-enoylpiperidin-4-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 60949730 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-(1-prop-2-enoylpiperidin-4-yl)ethanesulfonamide |
| SMILES | C=CC(=O)N1CCC(NS(=O)(=O)CC)CC1 |
| InChI | InChI=1S/C10H18N2O3S/c1-3-10(13)12-7-5-9(6-8-12)11-16(14,15)4-2/h3,9,11H,1,4-8H2,2H3 |
| InChIKey | FEUQNDZHODQVGY-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|