C13H22N2O5S — CID 76992611
4-[4-(ethylsulfonylamino)piperidin-1-yl]-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 76992611) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is 4-[4-(ethylsulfonylamino)piperidin-1-yl]-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-[4-(ethylsulfonylamino)piperidin-1-yl]-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76992611 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-[4-(ethylsulfonylamino)piperidin-1-yl]-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CCS(=O)(=O)NC1CCN(C(=O)C(C)=C(C)C(=O)O)CC1 |
| InChI | InChI=1S/C13H22N2O5S/c1-4-21(19,20)14-11-5-7-15(8-6-11)12(16)9(2)10(3)13(17)18/h11,14H,4-8H2,1-3H3,(H,17,18) |
| InChIKey | SMFBOLPVNHKJHD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|