C12H18BrNO5S2 — CID 60950189
5-bromo-4-[2-methoxyethyl(2-methylpropyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 60950189) has the molecular formula C12H18BrNO5S2 and a molecular weight of 400.32 g/mol. Its IUPAC name is 5-bromo-4-[2-methoxyethyl(2-methylpropyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-bromo-4-[2-methoxyethyl(2-methylpropyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 60950189 |
| Molecular Formula | C12H18BrNO5S2 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | 5-bromo-4-[2-methoxyethyl(2-methylpropyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | COCCN(CC(C)C)S(=O)(=O)c1cc(C(=O)O)sc1Br |
| InChI | InChI=1S/C12H18BrNO5S2/c1-8(2)7-14(4-5-19-3)21(17,18)10-6-9(12(15)16)20-11(10)13/h6,8H,4-5,7H2,1-3H3,(H,15,16) |
| InChIKey | FYYHZUBSVDDKOJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |