C11H16BrNO4S2 — CID 43570048
5-bromo-4-[methyl(3-methylbutan-2-yl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 43570048) has the molecular formula C11H16BrNO4S2 and a molecular weight of 370.29 g/mol. Its IUPAC name is 5-bromo-4-[methyl(3-methylbutan-2-yl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-bromo-4-[methyl(3-methylbutan-2-yl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43570048 |
| Molecular Formula | C11H16BrNO4S2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 5-bromo-4-[methyl(3-methylbutan-2-yl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | CC(C)C(C)N(C)S(=O)(=O)c1cc(C(=O)O)sc1Br |
| InChI | InChI=1S/C11H16BrNO4S2/c1-6(2)7(3)13(4)19(16,17)9-5-8(11(14)15)18-10(9)12/h5-7H,1-4H3,(H,14,15) |
| InChIKey | QTVWEGSEXKQCDO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |