C10H21N3O6S2 — CID 60951985
4-[4-(dimethylsulfamoyl)piperazin-1-yl]sulfonylbutanoic acid (PubChem CID 60951985) has the molecular formula C10H21N3O6S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-[4-(dimethylsulfamoyl)piperazin-1-yl]sulfonylbutanoic acid.
| Compound Name | 4-[4-(dimethylsulfamoyl)piperazin-1-yl]sulfonylbutanoic acid |
|---|---|
| PubChem CID | 60951985 |
| Molecular Formula | C10H21N3O6S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-[4-(dimethylsulfamoyl)piperazin-1-yl]sulfonylbutanoic acid |
| SMILES | CN(C)S(=O)(=O)N1CCN(S(=O)(=O)CCCC(=O)O)CC1 |
| InChI | InChI=1S/C10H21N3O6S2/c1-11(2)21(18,19)13-7-5-12(6-8-13)20(16,17)9-3-4-10(14)15/h3-9H2,1-2H3,(H,14,15) |
| InChIKey | XBQPJLSQTBRWPX-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |