C10H19N3O5S2 — CID 115586808
2-[2-[4-(dimethylsulfamoyl)piperazin-1-yl]-2-oxoethyl]sulfanylacetic acid (PubChem CID 115586808) has the molecular formula C10H19N3O5S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[2-[4-(dimethylsulfamoyl)piperazin-1-yl]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[4-(dimethylsulfamoyl)piperazin-1-yl]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 115586808 |
| Molecular Formula | C10H19N3O5S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-[2-[4-(dimethylsulfamoyl)piperazin-1-yl]-2-oxoethyl]sulfanylacetic acid |
| SMILES | CN(C)S(=O)(=O)N1CCN(C(=O)CSCC(=O)O)CC1 |
| InChI | InChI=1S/C10H19N3O5S2/c1-11(2)20(17,18)13-5-3-12(4-6-13)9(14)7-19-8-10(15)16/h3-8H2,1-2H3,(H,15,16) |
| InChIKey | ZAAACJLNUKHMSB-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |