C10H19N3O5S — CID 43442487
2-[methyl-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]amino]acetic acid (PubChem CID 43442487) has the molecular formula C10H19N3O5S and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-[methyl-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[methyl-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 43442487 |
| Molecular Formula | C10H19N3O5S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-[methyl-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)CC(=O)N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C10H19N3O5S/c1-11(8-10(15)16)7-9(14)12-3-5-13(6-4-12)19(2,17)18/h3-8H2,1-2H3,(H,15,16) |
| InChIKey | WLLLNNCRTCJPQI-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |