C12H25N3O5S — CID 62016338
2-[(2-hydroxy-3-methoxypropyl)-methylamino]-1-(4-methylsulfonylpiperazin-1-yl)ethanone (PubChem CID 62016338) has the molecular formula C12H25N3O5S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-methoxypropyl)-methylamino]-1-(4-methylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-[(2-hydroxy-3-methoxypropyl)-methylamino]-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 62016338 |
| Molecular Formula | C12H25N3O5S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[(2-hydroxy-3-methoxypropyl)-methylamino]-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
| SMILES | COCC(O)CN(C)CC(=O)N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C12H25N3O5S/c1-13(8-11(16)10-20-2)9-12(17)14-4-6-15(7-5-14)21(3,18)19/h11,16H,4-10H2,1-3H3 |
| InChIKey | BWQMELPHHMWLAC-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |