About lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate)
lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate) (PubChem CID 6095733) has the molecular formula C18H20N2O2PbS2
and a molecular weight of 567.70 g/mol. Its IUPAC name is lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate).
Molecular Properties
| Compound Name | lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate) |
| PubChem CID | 6095733 |
| Molecular Formula | C18H20N2O2PbS2 |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate) |
| SMILES | Cc1ccc(NC(=O)C[S-])cc1.Cc1ccc(NC(=O)C[S-])cc1.[Pb+2] |
| InChI | InChI=1S/2C9H11NOS.Pb/c2*1-7-2-4-8(5-3-7)10-9(11)6-12;/h2*2-5,12H,6H2,1H3,(H,10,11);/q;;+2/p-2 |
| InChIKey | ODVHZUXATKICCO-UHFFFAOYSA-L |
| XLogP | 2.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate)?
The IUPAC name of lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate) (CID 6095733) is lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate).
What is the SMILES notation for lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate)?
The canonical SMILES for lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate) is Cc1ccc(NC(=O)C[S-])cc1.Cc1ccc(NC(=O)C[S-])cc1.[Pb+2].
What is the InChIKey of lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate)?
The InChIKey is ODVHZUXATKICCO-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H11NOS.Pb/c2*1-7-2-4-8(5-3-7)10-9(11)6-12;/h2*2-5,12H,6H2,1H3,(H,10,11);/q;;+2/p-2.
What are the key properties of lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate)?
lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate) has a molecular weight of 567.70 g/mol, XLogP of 2.58, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lead(2+);bis(2-(4-methylanilino)-2-oxoethanethiolate) is sourced from PubChem (CID 6095733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).