C7H17N3O2 — CID 60961042
N'-hydroxy-3-[2-hydroxyethyl(methyl)amino]butanimidamide (PubChem CID 60961042) has the molecular formula C7H17N3O2 and a molecular weight of 175.23 g/mol. Its IUPAC name is N'-hydroxy-3-[2-hydroxyethyl(methyl)amino]butanimidamide.
| Compound Name | N'-hydroxy-3-[2-hydroxyethyl(methyl)amino]butanimidamide |
|---|---|
| PubChem CID | 60961042 |
| Molecular Formula | C7H17N3O2 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.13 |
| IUPAC Name | N'-hydroxy-3-[2-hydroxyethyl(methyl)amino]butanimidamide |
| SMILES | CC(C/C(N)=N/O)N(C)CCO |
| InChI | InChI=1S/C7H17N3O2/c1-6(5-7(8)9-12)10(2)3-4-11/h6,11-12H,3-5H2,1-2H3,(H2,8,9) |
| InChIKey | YIROYPNQJQZLAA-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|