C10H19N3O2 — CID 60961334
3-(4-hydroxyiminopiperidin-1-yl)-N,N-dimethylpropanamide (PubChem CID 60961334) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-(4-hydroxyiminopiperidin-1-yl)-N,N-dimethylpropanamide.
| Compound Name | 3-(4-hydroxyiminopiperidin-1-yl)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 60961334 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3-(4-hydroxyiminopiperidin-1-yl)-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCN1CCC(=NO)CC1 |
| InChI | InChI=1S/C10H19N3O2/c1-12(2)10(14)5-8-13-6-3-9(11-15)4-7-13/h15H,3-8H2,1-2H3 |
| InChIKey | LCZJVOFCEOJBEM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|