C11H18N2S — CID 60967290
N-(4-ethylcyclohexyl)-1,3-thiazol-2-amine (PubChem CID 60967290) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)-1,3-thiazol-2-amine.
| Compound Name | N-(4-ethylcyclohexyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 60967290 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-(4-ethylcyclohexyl)-1,3-thiazol-2-amine |
| SMILES | CCC1CCC(Nc2nccs2)CC1 |
| InChI | InChI=1S/C11H18N2S/c1-2-9-3-5-10(6-4-9)13-11-12-7-8-14-11/h7-10H,2-6H2,1H3,(H,12,13) |
| InChIKey | UBDYAUWBYIUBLK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |