C9H9ClN4O — CID 60968792
4-chloro-N-(1H-imidazol-2-yl)-1-methylpyrrole-2-carboxamide (PubChem CID 60968792) has the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. Its IUPAC name is 4-chloro-N-(1H-imidazol-2-yl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-(1H-imidazol-2-yl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60968792 |
| Molecular Formula | C9H9ClN4O |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 4-chloro-N-(1H-imidazol-2-yl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(Cl)cc1C(=O)Nc1ncc[nH]1 |
| InChI | InChI=1S/C9H9ClN4O/c1-14-5-6(10)4-7(14)8(15)13-9-11-2-3-12-9/h2-5H,1H3,(H2,11,12,13,15) |
| InChIKey | KIYMLDWSBBHHBE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |